C20H18F2N2O2 — CID 51337726
N-[1-(3-ethynylanilino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide (PubChem CID 51337726) has the molecular formula C20H18F2N2O2 and a molecular weight of 356.37 g/mol. Its IUPAC name is N-[1-(3-ethynylanilino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[1-(3-ethynylanilino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 51337726 |
| Molecular Formula | C20H18F2N2O2 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[1-(3-ethynylanilino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
| SMILES | C#Cc1cccc(NC(=O)C(NC(=O)c2c(F)cccc2F)C(C)C)c1 |
| InChI | InChI=1S/C20H18F2N2O2/c1-4-13-7-5-8-14(11-13)23-20(26)18(12(2)3)24-19(25)17-15(21)9-6-10-16(17)22/h1,5-12,18H,2-3H3,(H,23,26)(H,24,25) |
| InChIKey | ALGBGAWBKOCFJY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|