C18H11Cl3F5N3O2S — CID 22205236
2,4,5-trichloro-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]benzenesulfonamide (PubChem CID 22205236) has the molecular formula C18H11Cl3F5N3O2S and a molecular weight of 534.72 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22205236 |
| Molecular Formula | C18H11Cl3F5N3O2S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 532.96 |
| IUPAC Name | 2,4,5-trichloro-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]benzenesulfonamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H11Cl3F5N3O2S/c1-6-18(28-32(30,31)12-4-10(20)9(19)3-11(12)21)7(2)29(27-6)5-8-13(22)15(24)17(26)16(25)14(8)23/h3-4,28H,5H2,1-2H3 |
| InChIKey | LHTDNFSMGFUMAI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|