C18H15Cl3FN3O2S — CID 22202034
2,4,5-trichloro-N-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]benzenesulfonamide (PubChem CID 22202034) has the molecular formula C18H15Cl3FN3O2S and a molecular weight of 462.76 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22202034 |
| Molecular Formula | C18H15Cl3FN3O2S |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | 2,4,5-trichloro-N-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]benzenesulfonamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(C)c1NS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl3FN3O2S/c1-10-18(11(2)25(23-10)9-12-3-5-13(22)6-4-12)24-28(26,27)17-8-15(20)14(19)7-16(17)21/h3-8,24H,9H2,1-2H3 |
| InChIKey | KCDJRXRTROWYQZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|