C17H13Cl4N3O2S — CID 22201809
2,4,5-trichloro-N-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]benzenesulfonamide (PubChem CID 22201809) has the molecular formula C17H13Cl4N3O2S and a molecular weight of 465.19 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22201809 |
| Molecular Formula | C17H13Cl4N3O2S |
| Molecular Weight | 465.19 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | 2,4,5-trichloro-N-[1-[(4-chlorophenyl)methyl]-5-methylpyrazol-3-yl]benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)nn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13Cl4N3O2S/c1-10-6-17(22-24(10)9-11-2-4-12(18)5-3-11)23-27(25,26)16-8-14(20)13(19)7-15(16)21/h2-8H,9H2,1H3,(H,22,23) |
| InChIKey | IKIIDXYEDFGHGO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.19 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|