C21H29NO4S — CID 22206221
N-[(3,4-diethoxyphenyl)methyl]-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 22206221) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)methyl]-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-[(3,4-diethoxyphenyl)methyl]-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22206221 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)methyl]-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | CCOc1ccc(CNS(=O)(=O)c2c(C)c(C)cc(C)c2C)cc1OCC |
| InChI | InChI=1S/C21H29NO4S/c1-7-25-19-10-9-18(12-20(19)26-8-2)13-22-27(23,24)21-16(5)14(3)11-15(4)17(21)6/h9-12,22H,7-8,13H2,1-6H3 |
| InChIKey | KRFUQEQGCDYXBX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |