C18H21NO4S — CID 852335
4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid (PubChem CID 852335) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid.
| Compound Name | 4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 852335 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NCc2ccc(C(=O)O)cc2)c1C |
| InChI | InChI=1S/C18H21NO4S/c1-11-9-12(2)14(4)17(13(11)3)24(22,23)19-10-15-5-7-16(8-6-15)18(20)21/h5-9,19H,10H2,1-4H3,(H,20,21) |
| InChIKey | PQPFGHOAPLHTAE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |