C12H12BrCl2N3O2S — CID 22206646
N-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]ethanesulfonamide (PubChem CID 22206646) has the molecular formula C12H12BrCl2N3O2S and a molecular weight of 413.12 g/mol. Its IUPAC name is N-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]ethanesulfonamide.
| Compound Name | N-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 22206646 |
| Molecular Formula | C12H12BrCl2N3O2S |
| Molecular Weight | 413.12 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | N-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1nn(Cc2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C12H12BrCl2N3O2S/c1-2-21(19,20)17-12-10(13)7-18(16-12)6-8-3-4-9(14)5-11(8)15/h3-5,7H,2,6H2,1H3,(H,16,17) |
| InChIKey | DZJYTMJRUKJXCX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.12 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |