C18H24F3N3O2S — CID 22207668
2,3,5,6-tetramethyl-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzenesulfonamide (PubChem CID 22207668) has the molecular formula C18H24F3N3O2S and a molecular weight of 403.47 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethyl-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22207668 |
| Molecular Formula | C18H24F3N3O2S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-[3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NCCCn2nc(C(F)(F)F)cc2C)c1C |
| InChI | InChI=1S/C18H24F3N3O2S/c1-11-9-12(2)15(5)17(14(11)4)27(25,26)22-7-6-8-24-13(3)10-16(23-24)18(19,20)21/h9-10,22H,6-8H2,1-5H3 |
| InChIKey | GRQIRHYSKQVBGQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|