C12H27O3Si2- — CID 22212037
2,2-dimethyl-3-trimethylsilyl-3-trimethylsilyloxybutanoate (PubChem CID 22212037) has the molecular formula C12H27O3Si2- and a molecular weight of 275.52 g/mol. Its IUPAC name is 2,2-dimethyl-3-trimethylsilyl-3-trimethylsilyloxybutanoate.
| Compound Name | 2,2-dimethyl-3-trimethylsilyl-3-trimethylsilyloxybutanoate |
|---|---|
| PubChem CID | 22212037 |
| Molecular Formula | C12H27O3Si2- |
| Molecular Weight | 275.52 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2,2-dimethyl-3-trimethylsilyl-3-trimethylsilyloxybutanoate |
| SMILES | CC(C)(C(=O)[O-])C(C)(O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H28O3Si2/c1-11(2,10(13)14)12(3,16(4,5)6)15-17(7,8)9/h1-9H3,(H,13,14)/p-1 |
| InChIKey | WXFARUJLSXVEPJ-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|