C19H24N2O2 — CID 22213628
(1S,9S,11R,12R,17S)-12-(1-hydroxyethyl)-10-methylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-12-ol (PubChem CID 22213628) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (1S,9S,11R,12R,17S)-12-(1-hydroxyethyl)-10-methylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-12-ol.
| Compound Name | (1S,9S,11R,12R,17S)-12-(1-hydroxyethyl)-10-methylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-12-ol |
|---|---|
| PubChem CID | 22213628 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (1S,9S,11R,12R,17S)-12-(1-hydroxyethyl)-10-methylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-12-ol |
| SMILES | C=C1[C@H]2C[C@@H]3N(CC[C@@]34c3ccccc3N[C@@H]14)C[C@@]2(O)C(C)O |
| InChI | InChI=1S/C19H24N2O2/c1-11-14-9-16-18(7-8-21(16)10-19(14,23)12(2)22)13-5-3-4-6-15(13)20-17(11)18/h3-6,12,14,16-17,20,22-23H,1,7-10H2,2H3/t12?,14-,16+,17+,18-,19-/m1/s1 |
| InChIKey | IRNGPWNWXQEXLE-RIPITDIQSA-N |
| XLogP | 1.49 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|