C19H22N2O4 — CID 101116718
ethyl (6aR,11bS)-3-acetyl-5-hydroxy-1,2,3a,4,6a,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 101116718) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethyl (6aR,11bS)-3-acetyl-5-hydroxy-1,2,3a,4,6a,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | ethyl (6aR,11bS)-3-acetyl-5-hydroxy-1,2,3a,4,6a,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 101116718 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | ethyl (6aR,11bS)-3-acetyl-5-hydroxy-1,2,3a,4,6a,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CC2N(C(C)=O)CC[C@@]23c2ccccc2N[C@@H]13 |
| InChI | InChI=1S/C19H22N2O4/c1-3-25-18(24)16-14(23)10-15-19(8-9-21(15)11(2)22)12-6-4-5-7-13(12)20-17(16)19/h4-7,15,17,20,23H,3,8-10H2,1-2H3/t15?,17-,19+/m0/s1 |
| InChIKey | QFWBASVMFOIMTR-IYSUZNMVSA-N |
| XLogP | 2.12 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |