C19H20N2O4 — CID 54685127
methyl (1R,9S,12R,19R)-11-hydroxy-17-oxo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,10-tetraene-10-carboxylate (PubChem CID 54685127) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl (1R,9S,12R,19R)-11-hydroxy-17-oxo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,10-tetraene-10-carboxylate.
| Compound Name | methyl (1R,9S,12R,19R)-11-hydroxy-17-oxo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,10-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 54685127 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | methyl (1R,9S,12R,19R)-11-hydroxy-17-oxo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,10-tetraene-10-carboxylate |
| SMILES | COC(=O)C1=C(O)[C@@H]2CCCN3C(=O)C[C@]4(c5ccccc5N[C@H]14)[C@@H]23 |
| InChI | InChI=1S/C19H20N2O4/c1-25-18(24)14-15(23)10-5-4-8-21-13(22)9-19(17(10)21)11-6-2-3-7-12(11)20-16(14)19/h2-3,6-7,10,16-17,20,23H,4-5,8-9H2,1H3/t10-,16+,17+,19+/m0/s1 |
| InChIKey | IYKDJSKROFMSDE-LBKLHDDRSA-N |
| XLogP | 1.73 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |