C19H24N2O — CID 23258257
(1R,9R,12S,14S,19R)-14-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-17-one (PubChem CID 23258257) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (1R,9R,12S,14S,19R)-14-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-17-one.
| Compound Name | (1R,9R,12S,14S,19R)-14-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-17-one |
|---|---|
| PubChem CID | 23258257 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (1R,9R,12S,14S,19R)-14-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-17-one |
| SMILES | CC[C@H]1C[C@@H]2CC[C@H]3Nc4ccccc4[C@]34CC(=O)N(C1)[C@H]24 |
| InChI | InChI=1S/C19H24N2O/c1-2-12-9-13-7-8-16-19(10-17(22)21(11-12)18(13)19)14-5-3-4-6-15(14)20-16/h3-6,12-13,16,18,20H,2,7-11H2,1H3/t12-,13-,16+,18+,19+/m0/s1 |
| InChIKey | WOMBXRJFTPGALV-HRRIWVOMSA-N |
| XLogP | 3.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |