C26H37IN2O3Si — CID 134834931
methyl (6aR,11bS)-3-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobut-2-enyl]-1,2,3a,4,6a,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 134834931) has the molecular formula C26H37IN2O3Si and a molecular weight of 580.58 g/mol. Its IUPAC name is methyl (6aR,11bS)-3-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobut-2-enyl]-1,2,3a,4,6a,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (6aR,11bS)-3-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobut-2-enyl]-1,2,3a,4,6a,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 134834931 |
| Molecular Formula | C26H37IN2O3Si |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | methyl (6aR,11bS)-3-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobut-2-enyl]-1,2,3a,4,6a,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | COC(=O)C1=CCC2N(C/C(I)=C/CO[Si](C)(C)C(C)(C)C)CC[C@@]23c2ccccc2N[C@@H]13 |
| InChI | InChI=1S/C26H37IN2O3Si/c1-25(2,3)33(5,6)32-16-13-18(27)17-29-15-14-26-20-9-7-8-10-21(20)28-23(26)19(24(30)31-4)11-12-22(26)29/h7-11,13,22-23,28H,12,14-17H2,1-6H3/b18-13-/t22?,23-,26+/m0/s1 |
| InChIKey | ZOUCGYMYQSRQII-HIYJXOIESA-N |
| XLogP | 5.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|