C35H50N2O3Si — CID 14750125
methyl 3-benzyl-4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]pentyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 14750125) has the molecular formula C35H50N2O3Si and a molecular weight of 574.88 g/mol. Its IUPAC name is methyl 3-benzyl-4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]pentyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl 3-benzyl-4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]pentyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 14750125 |
| Molecular Formula | C35H50N2O3Si |
| Molecular Weight | 574.88 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | methyl 3-benzyl-4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]pentyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | CCCC(CO[Si](C)(C)C(C)(C)C)CC1CC(C(=O)OC)=C2Nc3ccccc3C23CCN(Cc2ccccc2)C13 |
| InChI | InChI=1S/C35H50N2O3Si/c1-8-14-26(24-40-41(6,7)34(2,3)4)21-27-22-28(33(38)39-5)31-35(29-17-12-13-18-30(29)36-31)19-20-37(32(27)35)23-25-15-10-9-11-16-25/h9-13,15-18,26-27,32,36H,8,14,19-24H2,1-7H3 |
| InChIKey | BPHZZRXPEIWHKD-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.88 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|