C37H42N2O5 — CID 100975602
methyl (3aS,4R,11bR)-3-benzyl-4-[2-(1,3-dioxolan-2-yl)-4-phenylmethoxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 100975602) has the molecular formula C37H42N2O5 and a molecular weight of 594.75 g/mol. Its IUPAC name is methyl (3aS,4R,11bR)-3-benzyl-4-[2-(1,3-dioxolan-2-yl)-4-phenylmethoxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (3aS,4R,11bR)-3-benzyl-4-[2-(1,3-dioxolan-2-yl)-4-phenylmethoxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 100975602 |
| Molecular Formula | C37H42N2O5 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | methyl (3aS,4R,11bR)-3-benzyl-4-[2-(1,3-dioxolan-2-yl)-4-phenylmethoxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@@]23CCN(Cc2ccccc2)[C@H]3[C@H](CC(CCOCc2ccccc2)C2OCCO2)C1 |
| InChI | InChI=1S/C37H42N2O5/c1-41-35(40)30-23-29(22-28(36-43-20-21-44-36)16-19-42-25-27-12-6-3-7-13-27)34-37(31-14-8-9-15-32(31)38-33(30)37)17-18-39(34)24-26-10-4-2-5-11-26/h2-15,28-29,34,36,38H,16-25H2,1H3/t28?,29-,34+,37+/m1/s1 |
| InChIKey | FFNLOPPBXWYXII-RCJHSTNQSA-N |
| XLogP | 6.06 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|