C36H44N2O3Si — CID 11114543
methyl (3aR,11bS)-3-benzyl-4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 11114543) has the molecular formula C36H44N2O3Si and a molecular weight of 580.85 g/mol. Its IUPAC name is methyl (3aR,11bS)-3-benzyl-4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (3aR,11bS)-3-benzyl-4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 11114543 |
| Molecular Formula | C36H44N2O3Si |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | methyl (3aR,11bS)-3-benzyl-4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@]23CCN(Cc2ccccc2)[C@@H]3C(c2ccccc2CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C36H44N2O3Si/c1-35(2,3)42(5,6)41-24-26-16-10-11-17-27(26)28-22-29(34(39)40-4)32-36(30-18-12-13-19-31(30)37-32)20-21-38(33(28)36)23-25-14-8-7-9-15-25/h7-19,28,33,37H,20-24H2,1-6H3/t28?,33-,36-/m1/s1 |
| InChIKey | IGUQTEMHXFKWHN-JFZARQGHSA-N |
| XLogP | 7.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|