C26H38N2O3Si — CID 101426924
methyl (1R,12R,14R,18S)-14-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-8,15-diazapentacyclo[10.5.1.01,9.02,7.015,18]octadeca-2,4,6,9-tetraene-10-carboxylate (PubChem CID 101426924) has the molecular formula C26H38N2O3Si and a molecular weight of 454.69 g/mol. Its IUPAC name is methyl (1R,12R,14R,18S)-14-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-8,15-diazapentacyclo[10.5.1.01,9.02,7.015,18]octadeca-2,4,6,9-tetraene-10-carboxylate.
| Compound Name | methyl (1R,12R,14R,18S)-14-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-8,15-diazapentacyclo[10.5.1.01,9.02,7.015,18]octadeca-2,4,6,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 101426924 |
| Molecular Formula | C26H38N2O3Si |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | methyl (1R,12R,14R,18S)-14-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-8,15-diazapentacyclo[10.5.1.01,9.02,7.015,18]octadeca-2,4,6,9-tetraene-10-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@@]23CCN2[C@@H](C(C)O[Si](C)(C)C(C)(C)C)C[C@@H](C1)[C@H]23 |
| InChI | InChI=1S/C26H38N2O3Si/c1-16(31-32(6,7)25(2,3)4)21-15-17-14-18(24(29)30-5)22-26(12-13-28(21)23(17)26)19-10-8-9-11-20(19)27-22/h8-11,16-17,21,23,27H,12-15H2,1-7H3/t16?,17-,21-,23+,26+/m1/s1 |
| InChIKey | SIGJQYHHADKSET-BRIYMNNQSA-N |
| XLogP | 5.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|