C33H45BrN2O3Si — CID 15940444
methyl (3aS,11bR)-3-benzyl-4-[2-bromo-3-[tert-butyl(dimethyl)silyl]oxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 15940444) has the molecular formula C33H45BrN2O3Si and a molecular weight of 625.72 g/mol. Its IUPAC name is methyl (3aS,11bR)-3-benzyl-4-[2-bromo-3-[tert-butyl(dimethyl)silyl]oxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (3aS,11bR)-3-benzyl-4-[2-bromo-3-[tert-butyl(dimethyl)silyl]oxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 15940444 |
| Molecular Formula | C33H45BrN2O3Si |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | methyl (3aS,11bR)-3-benzyl-4-[2-bromo-3-[tert-butyl(dimethyl)silyl]oxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@@]23CCN(Cc2ccccc2)[C@H]3C(CC(Br)C(C)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C33H45BrN2O3Si/c1-22(39-40(6,7)32(2,3)4)27(34)20-24-19-25(31(37)38-5)29-33(26-15-11-12-16-28(26)35-29)17-18-36(30(24)33)21-23-13-9-8-10-14-23/h8-16,22,24,27,30,35H,17-21H2,1-7H3/t22?,24?,27?,30-,33-/m0/s1 |
| InChIKey | XGEGCWFJVSMJCQ-DTPQRIGKSA-N |
| XLogP | 7.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|