C30H35BrN2O5 — CID 25034167
methyl (3aS,4S,11bS)-3-benzyl-4-[(2S)-3-bromo-2-hydroxy-2-(2-methyl-1,3-dioxolan-2-yl)propyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 25034167) has the molecular formula C30H35BrN2O5 and a molecular weight of 583.52 g/mol. Its IUPAC name is methyl (3aS,4S,11bS)-3-benzyl-4-[(2S)-3-bromo-2-hydroxy-2-(2-methyl-1,3-dioxolan-2-yl)propyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (3aS,4S,11bS)-3-benzyl-4-[(2S)-3-bromo-2-hydroxy-2-(2-methyl-1,3-dioxolan-2-yl)propyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 25034167 |
| Molecular Formula | C30H35BrN2O5 |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | methyl (3aS,4S,11bS)-3-benzyl-4-[(2S)-3-bromo-2-hydroxy-2-(2-methyl-1,3-dioxolan-2-yl)propyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@]23CCN(Cc2ccccc2)[C@H]3[C@H](C[C@@](O)(CBr)C2(C)OCCO2)C1 |
| InChI | InChI=1S/C30H35BrN2O5/c1-28(37-14-15-38-28)29(35,19-31)17-21-16-22(27(34)36-2)25-30(23-10-6-7-11-24(23)32-25)12-13-33(26(21)30)18-20-8-4-3-5-9-20/h3-11,21,26,32,35H,12-19H2,1-2H3/t21-,26-,29+,30+/m0/s1 |
| InChIKey | SCBPWRKEDFRHEY-DUFLRHOZSA-N |
| XLogP | 4.35 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|