C38H48N2O6SSi — CID 14750148
methyl (3aR,4R,11bS)-3-benzyl-4-[(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]-2-trimethylsilyloxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 14750148) has the molecular formula C38H48N2O6SSi and a molecular weight of 688.96 g/mol. Its IUPAC name is methyl (3aR,4R,11bS)-3-benzyl-4-[(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]-2-trimethylsilyloxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (3aR,4R,11bS)-3-benzyl-4-[(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]-2-trimethylsilyloxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 14750148 |
| Molecular Formula | C38H48N2O6SSi |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | methyl (3aR,4R,11bS)-3-benzyl-4-[(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]-2-trimethylsilyloxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | CC[C@@](COS(=O)(=O)c1ccc(C)cc1)(C[C@H]1CC(C(=O)OC)=C2Nc3ccccc3[C@]23CCN(Cc2ccccc2)[C@H]13)O[Si](C)(C)C |
| InChI | InChI=1S/C38H48N2O6SSi/c1-7-37(46-48(4,5)6,26-45-47(42,43)30-19-17-27(2)18-20-30)24-29-23-31(36(41)44-3)34-38(32-15-11-12-16-33(32)39-34)21-22-40(35(29)38)25-28-13-9-8-10-14-28/h8-20,29,35,39H,7,21-26H2,1-6H3/t29-,35-,37+,38-/m1/s1 |
| InChIKey | OVXDCFYDQMXSLV-STDRQQSRSA-N |
| XLogP | 7.18 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|