C38H44N2O5S — CID 10875972
methyl (4aR,5R,12bS)-4-benzyl-5-[(1R,2R)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]-2,3,4a,5,6,8-hexahydro-1H-pyrido[2,3-d]carbazole-7-carboxylate (PubChem CID 10875972) has the molecular formula C38H44N2O5S and a molecular weight of 640.85 g/mol. Its IUPAC name is methyl (4aR,5R,12bS)-4-benzyl-5-[(1R,2R)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]-2,3,4a,5,6,8-hexahydro-1H-pyrido[2,3-d]carbazole-7-carboxylate.
| Compound Name | methyl (4aR,5R,12bS)-4-benzyl-5-[(1R,2R)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]-2,3,4a,5,6,8-hexahydro-1H-pyrido[2,3-d]carbazole-7-carboxylate |
|---|---|
| PubChem CID | 10875972 |
| Molecular Formula | C38H44N2O5S |
| Molecular Weight | 640.85 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | methyl (4aR,5R,12bS)-4-benzyl-5-[(1R,2R)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]-2,3,4a,5,6,8-hexahydro-1H-pyrido[2,3-d]carbazole-7-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@]23CCCN(Cc2ccccc2)[C@@H]3[C@@H]([C@H]2CCCC[C@H]2COS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C38H44N2O5S/c1-26-17-19-29(20-18-26)46(42,43)45-25-28-13-6-7-14-30(28)31-23-32(37(41)44-2)35-38(33-15-8-9-16-34(33)39-35)21-10-22-40(36(31)38)24-27-11-4-3-5-12-27/h3-5,8-9,11-12,15-20,28,30-31,36,39H,6-7,10,13-14,21-25H2,1-2H3/t28-,30-,31+,36+,38+/m0/s1 |
| InChIKey | YRITZHITOHUMLO-OZLXSTSPSA-N |
| XLogP | 6.98 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.85 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|