C35H40N2O5S — CID 10995600
methyl (3aR,4S,11bS)-3-benzyl-4-[5-(4-methylphenyl)sulfonyloxypentyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 10995600) has the molecular formula C35H40N2O5S and a molecular weight of 600.78 g/mol. Its IUPAC name is methyl (3aR,4S,11bS)-3-benzyl-4-[5-(4-methylphenyl)sulfonyloxypentyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (3aR,4S,11bS)-3-benzyl-4-[5-(4-methylphenyl)sulfonyloxypentyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 10995600 |
| Molecular Formula | C35H40N2O5S |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | methyl (3aR,4S,11bS)-3-benzyl-4-[5-(4-methylphenyl)sulfonyloxypentyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@]23CCN(Cc2ccccc2)[C@@H]3[C@@H](CCCCCOS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C35H40N2O5S/c1-25-16-18-28(19-17-25)43(39,40)42-22-10-4-7-13-27-23-29(34(38)41-2)32-35(30-14-8-9-15-31(30)36-32)20-21-37(33(27)35)24-26-11-5-3-6-12-26/h3,5-6,8-9,11-12,14-19,27,33,36H,4,7,10,13,20-24H2,1-2H3/t27-,33+,35+/m0/s1 |
| InChIKey | IQPJZPZLBYCABI-NKPPDARJSA-N |
| XLogP | 6.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|