C33H46N2O3Si — CID 11827719
methyl (3aR,4S,11bS)-3-benzyl-4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 11827719) has the molecular formula C33H46N2O3Si and a molecular weight of 546.83 g/mol. Its IUPAC name is methyl (3aR,4S,11bS)-3-benzyl-4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (3aR,4S,11bS)-3-benzyl-4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 11827719 |
| Molecular Formula | C33H46N2O3Si |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | methyl (3aR,4S,11bS)-3-benzyl-4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1,2,3a,4,5,7-hexahydropyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@]23CCN(Cc2ccccc2)[C@@H]3[C@@H](CCCCO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C33H46N2O3Si/c1-32(2,3)39(5,6)38-21-13-12-16-25-22-26(31(36)37-4)29-33(27-17-10-11-18-28(27)34-29)19-20-35(30(25)33)23-24-14-8-7-9-15-24/h7-11,14-15,17-18,25,30,34H,12-13,16,19-23H2,1-6H3/t25-,30+,33+/m0/s1 |
| InChIKey | LQYSJRQPJFYJPI-MWWWQXCZSA-N |
| XLogP | 7.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|