C24H41NO — CID 22213745
1-[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(propan-2-ylideneamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol (PubChem CID 22213745) has the molecular formula C24H41NO and a molecular weight of 359.60 g/mol. Its IUPAC name is 1-[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(propan-2-ylideneamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol.
| Compound Name | 1-[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(propan-2-ylideneamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol |
|---|---|
| PubChem CID | 22213745 |
| Molecular Formula | C24H41NO |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | 1-[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-(propan-2-ylideneamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol |
| SMILES | CC(C)=NC1CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H](C(C)O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C24H41NO/c1-15(2)25-18-10-12-23(4)17(14-18)6-7-19-21-9-8-20(16(3)26)24(21,5)13-11-22(19)23/h16-22,26H,6-14H2,1-5H3/t16?,17?,18?,19-,20+,21-,22-,23-,24+/m0/s1 |
| InChIKey | QRFNAMVNTMNDME-WRWVCIHISA-N |
| XLogP | 5.88 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|