C9H16Si — CID 22214149
[(1R,2S)-2-ethenyl-3-methylidenecyclopropyl]-trimethylsilane (PubChem CID 22214149) has the molecular formula C9H16Si and a molecular weight of 152.31 g/mol. Its IUPAC name is [(1R,2S)-2-ethenyl-3-methylidenecyclopropyl]-trimethylsilane.
| Compound Name | [(1R,2S)-2-ethenyl-3-methylidenecyclopropyl]-trimethylsilane |
|---|---|
| PubChem CID | 22214149 |
| Molecular Formula | C9H16Si |
| Molecular Weight | 152.31 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | [(1R,2S)-2-ethenyl-3-methylidenecyclopropyl]-trimethylsilane |
| SMILES | C=C[C@H]1C(=C)[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C9H16Si/c1-6-8-7(2)9(8)10(3,4)5/h6,8-9H,1-2H2,3-5H3/t8-,9-/m0/s1 |
| InChIKey | QJIIUBPXNWULEZ-IUCAKERBSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|