C11H15N2O4P — CID 22215219
[dimethylphosphorylmethyl(phenyl)carbamoyl]carbamic acid (PubChem CID 22215219) has the molecular formula C11H15N2O4P and a molecular weight of 270.23 g/mol. Its IUPAC name is [dimethylphosphorylmethyl(phenyl)carbamoyl]carbamic acid.
| Compound Name | [dimethylphosphorylmethyl(phenyl)carbamoyl]carbamic acid |
|---|---|
| PubChem CID | 22215219 |
| Molecular Formula | C11H15N2O4P |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [dimethylphosphorylmethyl(phenyl)carbamoyl]carbamic acid |
| SMILES | CP(C)(=O)CN(C(=O)NC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H15N2O4P/c1-18(2,17)8-13(10(14)12-11(15)16)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,12,14)(H,15,16) |
| InChIKey | SKPSAZLQAGOHTP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|