C17H20N2O — CID 139024055
1,3-bis(1,1,2,2,2-pentadeuterioethyl)-1,3-diphenylurea (PubChem CID 139024055) has the molecular formula C17H20N2O and a molecular weight of 278.42 g/mol. Its IUPAC name is 1,3-bis(1,1,2,2,2-pentadeuterioethyl)-1,3-diphenylurea.
| Compound Name | 1,3-bis(1,1,2,2,2-pentadeuterioethyl)-1,3-diphenylurea |
|---|---|
| PubChem CID | 139024055 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1,3-bis(1,1,2,2,2-pentadeuterioethyl)-1,3-diphenylurea |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C(=O)N(c1ccccc1)C([2H])([2H])C([2H])([2H])[2H])c1ccccc1 |
| InChI | InChI=1S/C17H20N2O/c1-3-18(15-11-7-5-8-12-15)17(20)19(4-2)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3/i1D3,2D3,3D2,4D2 |
| InChIKey | PZIMIYVOZBTARW-MWUKXHIBSA-N |
| XLogP | 4.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |