C20H18N2O6 — CID 2221584
3-[5-[[2-(2-methylphenoxy)acetyl]amino]-1,3-dioxoisoindol-2-yl]propanoic acid (PubChem CID 2221584) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is 3-[5-[[2-(2-methylphenoxy)acetyl]amino]-1,3-dioxoisoindol-2-yl]propanoic acid.
| Compound Name | 3-[5-[[2-(2-methylphenoxy)acetyl]amino]-1,3-dioxoisoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 2221584 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[5-[[2-(2-methylphenoxy)acetyl]amino]-1,3-dioxoisoindol-2-yl]propanoic acid |
| SMILES | Cc1ccccc1OCC(=O)Nc1ccc2c(c1)C(=O)N(CCC(=O)O)C2=O |
| InChI | InChI=1S/C20H18N2O6/c1-12-4-2-3-5-16(12)28-11-17(23)21-13-6-7-14-15(10-13)20(27)22(19(14)26)9-8-18(24)25/h2-7,10H,8-9,11H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | FEQFNFWTVBCNBH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|