C17H14N2O4 — CID 2953904
N-(1,3-dioxoisoindol-5-yl)-2-(2-methoxyphenyl)acetamide (PubChem CID 2953904) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2953904 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C17H14N2O4/c1-23-14-5-3-2-4-10(14)8-15(20)18-11-6-7-12-13(9-11)17(22)19-16(12)21/h2-7,9H,8H2,1H3,(H,18,20)(H,19,21,22) |
| InChIKey | YAFURKYVZHYYFH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|