C9H15NO — CID 22215874
4-butyl-5-methyl-2,4-dihydropyrrol-3-one (PubChem CID 22215874) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-butyl-5-methyl-2,4-dihydropyrrol-3-one.
| Compound Name | 4-butyl-5-methyl-2,4-dihydropyrrol-3-one |
|---|---|
| PubChem CID | 22215874 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-butyl-5-methyl-2,4-dihydropyrrol-3-one |
| SMILES | CCCCC1C(=O)CN=C1C |
| InChI | InChI=1S/C9H15NO/c1-3-4-5-8-7(2)10-6-9(8)11/h8H,3-6H2,1-2H3 |
| InChIKey | HNVZTSHCDWSADC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |