C33H64O2Si2 — CID 22216535
[(3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[(1R)-1-triethylsilyloxyethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-triethylsilane (PubChem CID 22216535) has the molecular formula C33H64O2Si2 and a molecular weight of 549.05 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[(1R)-1-triethylsilyloxyethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-triethylsilane.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[(1R)-1-triethylsilyloxyethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 22216535 |
| Molecular Formula | C33H64O2Si2 |
| Molecular Weight | 549.05 g/mol |
| Exact Mass | 548.44 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[(1R)-1-triethylsilyloxyethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@@H](C)O[Si](CC)(CC)CC)CC[C@@H]32)C1 |
| InChI | InChI=1S/C33H64O2Si2/c1-10-36(11-2,12-3)34-25(7)29-18-19-30-28-17-16-26-24-27(35-37(13-4,14-5)15-6)20-22-32(26,8)31(28)21-23-33(29,30)9/h25-31H,10-24H2,1-9H3/t25-,26+,27+,28+,29-,30+,31+,32+,33-/m1/s1 |
| InChIKey | CVGOHPKBYUFUMD-FOLUXKCPSA-N |
| XLogP | 10.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.05 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|