C10H9BrO2 — CID 22217242
11-bromo-2-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-9-one (PubChem CID 22217242) has the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. Its IUPAC name is 11-bromo-2-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-9-one.
| Compound Name | 11-bromo-2-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-9-one |
|---|---|
| PubChem CID | 22217242 |
| Molecular Formula | C10H9BrO2 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 11-bromo-2-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-9-one |
| SMILES | O=C1C2C3C=CC2C2OC3C(Br)C12 |
| InChI | InChI=1S/C10H9BrO2/c11-7-6-8(12)5-3-1-2-4(5)10(7)13-9(3)6/h1-7,9-10H |
| InChIKey | JWXMRNGAVYTVFW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|