C23H16BrFN2O4 — CID 2222184
(Z)-3-[2-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-fluorophenyl)prop-2-enenitrile (PubChem CID 2222184) has the molecular formula C23H16BrFN2O4 and a molecular weight of 483.29 g/mol. Its IUPAC name is (Z)-3-[2-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-fluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2222184 |
| Molecular Formula | C23H16BrFN2O4 |
| Molecular Weight | 483.29 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | (Z)-3-[2-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(4-fluorophenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)c2ccc(F)cc2)c(Br)cc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16BrFN2O4/c1-30-22-11-17(10-18(13-26)16-5-7-19(25)8-6-16)21(24)12-23(22)31-14-15-3-2-4-20(9-15)27(28)29/h2-12H,14H2,1H3/b18-10+ |
| InChIKey | PMULBCQYWCYDOD-VCHYOVAHSA-N |
| XLogP | 6.15 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.29 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|