C20H21N3O — CID 22223551
N-(9-ethylcarbazol-3-yl)-4-methylidenepyrrolidine-2-carboxamide (PubChem CID 22223551) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(9-ethylcarbazol-3-yl)-4-methylidenepyrrolidine-2-carboxamide.
| Compound Name | N-(9-ethylcarbazol-3-yl)-4-methylidenepyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22223551 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(9-ethylcarbazol-3-yl)-4-methylidenepyrrolidine-2-carboxamide |
| SMILES | C=C1CNC(C(=O)Nc2ccc3c(c2)c2ccccc2n3CC)C1 |
| InChI | InChI=1S/C20H21N3O/c1-3-23-18-7-5-4-6-15(18)16-11-14(8-9-19(16)23)22-20(24)17-10-13(2)12-21-17/h4-9,11,17,21H,2-3,10,12H2,1H3,(H,22,24) |
| InChIKey | GBMBYWGODHEYLR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|