C20H22N4O2 — CID 87752450
(2S,4E)-N-(9-ethylcarbazol-3-yl)-4-methoxyiminopyrrolidine-2-carboxamide (PubChem CID 87752450) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2S,4E)-N-(9-ethylcarbazol-3-yl)-4-methoxyiminopyrrolidine-2-carboxamide.
| Compound Name | (2S,4E)-N-(9-ethylcarbazol-3-yl)-4-methoxyiminopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87752450 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2S,4E)-N-(9-ethylcarbazol-3-yl)-4-methoxyiminopyrrolidine-2-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)[C@@H]3C/C(=N\OC)CN3)ccc21 |
| InChI | InChI=1S/C20H22N4O2/c1-3-24-18-7-5-4-6-15(18)16-10-13(8-9-19(16)24)22-20(25)17-11-14(12-21-17)23-26-2/h4-10,17,21H,3,11-12H2,1-2H3,(H,22,25)/b23-14+/t17-/m0/s1 |
| InChIKey | PCZXZFXPPMCQFU-QIWJOQEQSA-N |
| XLogP | 3.12 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|