About 4,4'-Dichlorodiphenylsilane
4,4'-Dichlorodiphenylsilane (PubChem CID 22226207) has the molecular formula C12H8Cl2Si
and a molecular weight of 251.19 g/mol.
Molecular Properties
| Compound Name | 4,4'-Dichlorodiphenylsilane |
| PubChem CID | 22226207 |
| Molecular Formula | C12H8Cl2Si |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | — |
| SMILES | Clc1ccc([Si]c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C12H8Cl2Si/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H |
| InChIKey | HMMSUWBOWJSKJE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,4'-Dichlorodiphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4'-Dichlorodiphenylsilane?
The IUPAC name of 4,4'-Dichlorodiphenylsilane (CID 22226207) is not available.
What is the SMILES notation for 4,4'-Dichlorodiphenylsilane?
The canonical SMILES for 4,4'-Dichlorodiphenylsilane is Clc1ccc([Si]c2ccc(Cl)cc2)cc1.
What is the InChIKey of 4,4'-Dichlorodiphenylsilane?
The InChIKey is HMMSUWBOWJSKJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2Si/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H.
What are the key properties of 4,4'-Dichlorodiphenylsilane?
4,4'-Dichlorodiphenylsilane has a molecular weight of 251.19 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4'-Dichlorodiphenylsilane is sourced from PubChem (CID 22226207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).