About CID 22228898
CID 22228898 (PubChem CID 22228898) has the molecular formula C11H21Si
and a molecular weight of 181.37 g/mol.
Molecular Properties
| Compound Name | CID 22228898 |
| PubChem CID | 22228898 |
| Molecular Formula | C11H21Si |
| Molecular Weight | 181.37 g/mol |
| Exact Mass | 181.14 |
| IUPAC Name | — |
| SMILES | C=CC([Si])(CC(C)C)CC(C)C |
| InChI | InChI=1S/C11H21Si/c1-6-11(12,7-9(2)3)8-10(4)5/h6,9-10H,1,7-8H2,2-5H3 |
| InChIKey | VPIWNRKJCGEVKD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 22228898 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22228898?
The IUPAC name of CID 22228898 (CID 22228898) is not available.
What is the SMILES notation for CID 22228898?
The canonical SMILES for CID 22228898 is C=CC([Si])(CC(C)C)CC(C)C.
What is the InChIKey of CID 22228898?
The InChIKey is VPIWNRKJCGEVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21Si/c1-6-11(12,7-9(2)3)8-10(4)5/h6,9-10H,1,7-8H2,2-5H3.
What are the key properties of CID 22228898?
CID 22228898 has a molecular weight of 181.37 g/mol, XLogP of 3.59, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22228898 is sourced from PubChem (CID 22228898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).