About CID 22229034
CID 22229034 (PubChem CID 22229034) has the molecular formula C8H17OSi
and a molecular weight of 157.31 g/mol.
Molecular Properties
| Compound Name | CID 22229034 |
| PubChem CID | 22229034 |
| Molecular Formula | C8H17OSi |
| Molecular Weight | 157.31 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | — |
| SMILES | C=CCCCCO[Si](C)C |
| InChI | InChI=1S/C8H17OSi/c1-4-5-6-7-8-9-10(2)3/h4H,1,5-8H2,2-3H3 |
| InChIKey | BPUHMQXTBQIRGO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 22229034 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22229034?
The IUPAC name of CID 22229034 (CID 22229034) is not available.
What is the SMILES notation for CID 22229034?
The canonical SMILES for CID 22229034 is C=CCCCCO[Si](C)C.
What is the InChIKey of CID 22229034?
The InChIKey is BPUHMQXTBQIRGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17OSi/c1-4-5-6-7-8-9-10(2)3/h4H,1,5-8H2,2-3H3.
What are the key properties of CID 22229034?
CID 22229034 has a molecular weight of 157.31 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22229034 is sourced from PubChem (CID 22229034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).