C10H15Br2NO2 — CID 22236336
[4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid (PubChem CID 22236336) has the molecular formula C10H15Br2NO2 and a molecular weight of 341.04 g/mol. Its IUPAC name is [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid.
| Compound Name | [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 22236336 |
| Molecular Formula | C10H15Br2NO2 |
| Molecular Weight | 341.04 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CCC(C=C(Br)Br)CC1 |
| InChI | InChI=1S/C10H15Br2NO2/c1-13(10(14)15)8-4-2-7(3-5-8)6-9(11)12/h6-8H,2-5H2,1H3,(H,14,15) |
| InChIKey | XABRABYILSQNKW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.04 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |