[4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid

C10H15Br2NO2 — CID 22236336

IUPAC[4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid
SMILESCN(C(=O)O)C1CCC(C=C(Br)Br)CC1
InChIInChI=1S/C10H15Br2NO2/c1-13(10(14)15)8-4-2-7(3-5-8)6-9(11)12/h6-8H,2-5H2,1H3,(H,14,15)
InChIKeyXABRABYILSQNKW-UHFFFAOYSA-N
MW341.04 g/mol
LogP3.79
Rot. Bonds2

About [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid

[4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid (PubChem CID 22236336) has the molecular formula C10H15Br2NO2 and a molecular weight of 341.04 g/mol. Its IUPAC name is [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid.

Molecular Properties

Compound Name[4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid
PubChem CID22236336
Molecular FormulaC10H15Br2NO2
Molecular Weight341.04 g/mol
Exact Mass338.95
IUPAC Name[4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid
SMILESCN(C(=O)O)C1CCC(C=C(Br)Br)CC1
InChIInChI=1S/C10H15Br2NO2/c1-13(10(14)15)8-4-2-7(3-5-8)6-9(11)12/h6-8H,2-5H2,1H3,(H,14,15)
InChIKeyXABRABYILSQNKW-UHFFFAOYSA-N
XLogP3.79
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.04
LogP ≤ 53.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid?
The IUPAC name of [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid (CID 22236336) is [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid.
What is the SMILES notation for [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid?
The canonical SMILES for [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid is CN(C(=O)O)C1CCC(C=C(Br)Br)CC1.
What is the InChIKey of [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid?
The InChIKey is XABRABYILSQNKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Br2NO2/c1-13(10(14)15)8-4-2-7(3-5-8)6-9(11)12/h6-8H,2-5H2,1H3,(H,14,15).
What are the key properties of [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid?
[4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid has a molecular weight of 341.04 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-dibromoethenyl)cyclohexyl]-methylcarbamic acid is sourced from PubChem (CID 22236336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).