C11H20BrNO3 — CID 22567962
[4-(2-bromoethoxymethyl)cyclohexyl]-methylcarbamic acid (PubChem CID 22567962) has the molecular formula C11H20BrNO3 and a molecular weight of 294.19 g/mol. Its IUPAC name is [4-(2-bromoethoxymethyl)cyclohexyl]-methylcarbamic acid.
| Compound Name | [4-(2-bromoethoxymethyl)cyclohexyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 22567962 |
| Molecular Formula | C11H20BrNO3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | [4-(2-bromoethoxymethyl)cyclohexyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CCC(COCCBr)CC1 |
| InChI | InChI=1S/C11H20BrNO3/c1-13(11(14)15)10-4-2-9(3-5-10)8-16-7-6-12/h9-10H,2-8H2,1H3,(H,14,15) |
| InChIKey | OBRXNIWECIGQCA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|