C11H17O4- — CID 22236514
8-ethyl-1,4-dioxaspiro[4.5]decane-8-carboxylate (PubChem CID 22236514) has the molecular formula C11H17O4- and a molecular weight of 213.25 g/mol. Its IUPAC name is 8-ethyl-1,4-dioxaspiro[4.5]decane-8-carboxylate.
| Compound Name | 8-ethyl-1,4-dioxaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 22236514 |
| Molecular Formula | C11H17O4- |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 8-ethyl-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| SMILES | CCC1(C(=O)[O-])CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H18O4/c1-2-10(9(12)13)3-5-11(6-4-10)14-7-8-15-11/h2-8H2,1H3,(H,12,13)/p-1 |
| InChIKey | MEUTXOHJZRIHFF-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |