C20H23NO — CID 22237342
2-(5,5-dimethylpyrrolidin-2-yl)-1-(4-phenylphenyl)ethanone (PubChem CID 22237342) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-(5,5-dimethylpyrrolidin-2-yl)-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-(5,5-dimethylpyrrolidin-2-yl)-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 22237342 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-(5,5-dimethylpyrrolidin-2-yl)-1-(4-phenylphenyl)ethanone |
| SMILES | CC1(C)CCC(CC(=O)c2ccc(-c3ccccc3)cc2)N1 |
| InChI | InChI=1S/C20H23NO/c1-20(2)13-12-18(21-20)14-19(22)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-11,18,21H,12-14H2,1-2H3 |
| InChIKey | RIEBKPLCULBJGM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |