C22H30F3N3O4S — CID 22240616
N-[[4-(cyclohexen-1-yl)piperidin-4-yl]-(dimethylsulfamoyl)methyl]-2-(trifluoromethoxy)benzamide (PubChem CID 22240616) has the molecular formula C22H30F3N3O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is N-[[4-(cyclohexen-1-yl)piperidin-4-yl]-(dimethylsulfamoyl)methyl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[[4-(cyclohexen-1-yl)piperidin-4-yl]-(dimethylsulfamoyl)methyl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 22240616 |
| Molecular Formula | C22H30F3N3O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | N-[[4-(cyclohexen-1-yl)piperidin-4-yl]-(dimethylsulfamoyl)methyl]-2-(trifluoromethoxy)benzamide |
| SMILES | CN(C)S(=O)(=O)C(NC(=O)c1ccccc1OC(F)(F)F)C1(C2=CCCCC2)CCNCC1 |
| InChI | InChI=1S/C22H30F3N3O4S/c1-28(2)33(30,31)20(21(12-14-26-15-13-21)16-8-4-3-5-9-16)27-19(29)17-10-6-7-11-18(17)32-22(23,24)25/h6-8,10-11,20,26H,3-5,9,12-15H2,1-2H3,(H,27,29) |
| InChIKey | LJMBPUQVQLFPDV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|