C22H27F2N3O4S — CID 67420131
2-(difluoromethoxy)-N-[dimethylsulfamoyl-(4-phenylpiperidin-4-yl)methyl]benzamide (PubChem CID 67420131) has the molecular formula C22H27F2N3O4S and a molecular weight of 467.54 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[dimethylsulfamoyl-(4-phenylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[dimethylsulfamoyl-(4-phenylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 67420131 |
| Molecular Formula | C22H27F2N3O4S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-(difluoromethoxy)-N-[dimethylsulfamoyl-(4-phenylpiperidin-4-yl)methyl]benzamide |
| SMILES | CN(C)S(=O)(=O)C(NC(=O)c1ccccc1OC(F)F)C1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C22H27F2N3O4S/c1-27(2)32(29,30)20(22(12-14-25-15-13-22)16-8-4-3-5-9-16)26-19(28)17-10-6-7-11-18(17)31-21(23)24/h3-11,20-21,25H,12-15H2,1-2H3,(H,26,28) |
| InChIKey | MLVAYCKDERHGBK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |