C28H26ClNO5 — CID 22241364
2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid (PubChem CID 22241364) has the molecular formula C28H26ClNO5 and a molecular weight of 491.97 g/mol. Its IUPAC name is 2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid.
| Compound Name | 2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 22241364 |
| Molecular Formula | C28H26ClNO5 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid |
| SMILES | CCCC(Oc1ccc(Cl)cc1COc1cccc(OCc2ccc3ccccc3n2)c1)C(=O)O |
| InChI | InChI=1S/C28H26ClNO5/c1-2-6-27(28(31)32)35-26-14-12-21(29)15-20(26)17-33-23-8-5-9-24(16-23)34-18-22-13-11-19-7-3-4-10-25(19)30-22/h3-5,7-16,27H,2,6,17-18H2,1H3,(H,31,32) |
| InChIKey | OBZBGRXRCABBFR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |