C10H6Cl3N — CID 22241391
6,7-dichloro-2-(chloromethyl)quinoline (PubChem CID 22241391) has the molecular formula C10H6Cl3N and a molecular weight of 246.52 g/mol. Its IUPAC name is 6,7-dichloro-2-(chloromethyl)quinoline.
| Compound Name | 6,7-dichloro-2-(chloromethyl)quinoline |
|---|---|
| PubChem CID | 22241391 |
| Molecular Formula | C10H6Cl3N |
| Molecular Weight | 246.52 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | 6,7-dichloro-2-(chloromethyl)quinoline |
| SMILES | ClCc1ccc2cc(Cl)c(Cl)cc2n1 |
| InChI | InChI=1S/C10H6Cl3N/c11-5-7-2-1-6-3-8(12)9(13)4-10(6)14-7/h1-4H,5H2 |
| InChIKey | JUKPQDIFUMAWTD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|