C22H28Cl2N4O — CID 22245704
2-(4-amino-2,5-dichloroanilino)-N-methyl-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide (PubChem CID 22245704) has the molecular formula C22H28Cl2N4O and a molecular weight of 435.40 g/mol. Its IUPAC name is 2-(4-amino-2,5-dichloroanilino)-N-methyl-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(4-amino-2,5-dichloroanilino)-N-methyl-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 22245704 |
| Molecular Formula | C22H28Cl2N4O |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-(4-amino-2,5-dichloroanilino)-N-methyl-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide |
| SMILES | CN(C(=O)CNc1cc(Cl)c(N)cc1Cl)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28Cl2N4O/c1-27(22(29)15-26-21-14-18(23)20(25)13-19(21)24)17-8-11-28(12-9-17)10-7-16-5-3-2-4-6-16/h2-6,13-14,17,26H,7-12,15,25H2,1H3 |
| InChIKey | PYBQYANSVNWVQB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|