C28H38N2O4 — CID 22246571
2-[[4-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-hydroxyethyl)-3-methylpyrrolidin-1-yl]amino]-3-phenylpropanal (PubChem CID 22246571) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is 2-[[4-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-hydroxyethyl)-3-methylpyrrolidin-1-yl]amino]-3-phenylpropanal.
| Compound Name | 2-[[4-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-hydroxyethyl)-3-methylpyrrolidin-1-yl]amino]-3-phenylpropanal |
|---|---|
| PubChem CID | 22246571 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 2-[[4-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-hydroxyethyl)-3-methylpyrrolidin-1-yl]amino]-3-phenylpropanal |
| SMILES | COc1ccc(C2CN(NC(C=O)Cc3ccccc3)CC2(C)C(C)O)cc1OC1CCCC1 |
| InChI | InChI=1S/C28H38N2O4/c1-20(32)28(2)19-30(29-23(18-31)15-21-9-5-4-6-10-21)17-25(28)22-13-14-26(33-3)27(16-22)34-24-11-7-8-12-24/h4-6,9-10,13-14,16,18,20,23-25,29,32H,7-8,11-12,15,17,19H2,1-3H3 |
| InChIKey | MBBOLNDLHCRWFD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|