C13H24O5Si — CID 22246803
7-[tert-butyl(dimethyl)silyl]oxy-2,4-dioxoheptanoic acid (PubChem CID 22246803) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-2,4-dioxoheptanoic acid.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-2,4-dioxoheptanoic acid |
|---|---|
| PubChem CID | 22246803 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-2,4-dioxoheptanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C13H24O5Si/c1-13(2,3)19(4,5)18-8-6-7-10(14)9-11(15)12(16)17/h6-9H2,1-5H3,(H,16,17) |
| InChIKey | RGUFMWXJWKRXMA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|